2,5-Hexanedione, bis(phenylhydrazone) structure
|
Common Name | 2,5-Hexanedione, bis(phenylhydrazone) | ||
|---|---|---|---|---|
| CAS Number | 1095-15-4 | Molecular Weight | 294.39400 | |
| Density | 1.04g/cm3 | Boiling Point | 442.1ºC at 760mmHg | |
| Molecular Formula | C18H22N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.2ºC | |
| Name | N-[(E)-[(5E)-5-(phenylhydrazinylidene)hexan-2-ylidene]amino]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 442.1ºC at 760mmHg |
| Molecular Formula | C18H22N4 |
| Molecular Weight | 294.39400 |
| Flash Point | 221.2ºC |
| Exact Mass | 294.18400 |
| PSA | 48.78000 |
| LogP | 4.88860 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | JRBMZQNRXCXAFK-MXWIWYRXSA-N |
| SMILES | CC(CCC(C)=NNc1ccccc1)=NNc1ccccc1 |
| HS Code | 2928000090 |
|---|
|
~%
2,5-Hexanedione... CAS#:1095-15-4 |
| Literature: Schantl,J. Monatshefte fuer Chemie, 1974 , vol. 105, p. 229 - 239 |
|
~%
2,5-Hexanedione... CAS#:1095-15-4 |
| Literature: Paal Chemische Berichte, 1885 , vol. 18, p. 60 |
|
~%
2,5-Hexanedione... CAS#:1095-15-4 |
| Literature: Paal Chemische Berichte, 1885 , vol. 18, p. 60 |
|
~%
Detail
|
| Literature: Paal Chemische Berichte, vol. 18, p. 60 |
| Precursor 5 | |
|---|---|
| DownStream 5 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Hexan-2,5-dion-bis-phenylhydrazon |
| Acetonylaceton-bis-phenylhydrazon |
| Acetonylacetone bis(phenylhydrazone) |
| hexane-2,5-dione-bis-phenylhydrazone |
| 2,5-Hexanedione-bis(phenylhydrazone) |