N-CBZ-4,4'-BIPIPERIDINE structure
|
Common Name | N-CBZ-4,4'-BIPIPERIDINE | ||
|---|---|---|---|---|
| CAS Number | 109397-72-0 | Molecular Weight | 302.41100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzyl 4-piperidin-4-ylpiperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H26N2O2 |
|---|---|
| Molecular Weight | 302.41100 |
| Exact Mass | 302.19900 |
| PSA | 41.57000 |
| LogP | 3.30150 |
| InChIKey | ZYXVUJHYDUORFN-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)N1CCC(C2CCNCC2)CC1 |
| HS Code | 2933399090 |
|---|
|
~%
N-CBZ-4,4'-BIPI... CAS#:109397-72-0 |
| Literature: US2004/138226 A1, ; Page 22-23 ; |
|
~96%
N-CBZ-4,4'-BIPI... CAS#:109397-72-0 |
| Literature: US6344/449 B1, ; Example A21a) ; US6344449 B1, ; Example A21a) ; |
|
~%
N-CBZ-4,4'-BIPI... CAS#:109397-72-0 |
| Literature: Journal of the Chemical Society, , p. 3165,3171 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-Cbz-4,4'-bipiperidine |
| N'-benzyloxycarbonyl-4,4'-bipiperidine |
| AB1315 |