CPG-52364 structure
|
Common Name | CPG-52364 | ||
|---|---|---|---|---|
| CAS Number | 1093135-60-4 | Molecular Weight | N/A | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | N/A | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CPG-52364CPG-52364 (CPG52364) is an orally available, small molecule TLR7/8/9 antagonist for the treatment of systemic lupus erythematosus and other autoimmune disorders.. |
| Name | CPG52364 |
|---|
| InChIKey | TUOZJWZCVIRDKO-UHFFFAOYSA-N |
|---|---|
| SMILES | COc1cc2nc(-c3ccc(N4CCN(C)CC4)cc3)nc(NCCN3CCOCC3)c2cc1OC |