Ketocaine structure
|
Common Name | Ketocaine | ||
|---|---|---|---|---|
| CAS Number | 1092-46-2 | Molecular Weight | 291.42800 | |
| Density | 0.966g/cm3 | Boiling Point | 386.3ºC at 760mmHg | |
| Molecular Formula | C18H29NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.5ºC | |
Use of KetocaineKetocaine is a butyrophenone derivative, which possesses local anesthetic activity. |
| Name | 1-{2-[2-(Diisopropylamino)ethoxy]phenyl}-1-butanone |
|---|---|
| Synonym | More Synonyms |
| Description | Ketocaine is a butyrophenone derivative, which possesses local anesthetic activity. |
|---|---|
| Related Catalog | |
| In Vitro | Ketocaine modifies the oxygen consumption by tissues with prevailing anaerobic metabolism and to inhibit the mitotic activity of human lymphocytes in culture stimulated by phytohemagglutinin[1]. |
| References |
| Density | 0.966g/cm3 |
|---|---|
| Boiling Point | 386.3ºC at 760mmHg |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.42800 |
| Flash Point | 187.5ºC |
| Exact Mass | 291.22000 |
| PSA | 29.54000 |
| LogP | 4.16700 |
| Vapour Pressure | 3.57E-06mmHg at 25°C |
| Index of Refraction | 1.497 |
| InChIKey | UXAWFWFJXIANHZ-UHFFFAOYSA-N |
| SMILES | CCCC(=O)c1ccccc1OCCN(C(C)C)C(C)C |
| Storage condition | 2-8℃ |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-<2-Diaethylamino-aethoxycarbonyl>-phenthiazin |
| o-(Diisopropylaminoethoxy)-butyrophenon |
| EINECS 214-131-8 |
| 10H-phenothiazine-2-carboxylic acid 2-diethylamino-ethyl ester |
| 2-(N-Diisopropylaminoethoxy)-1-butyro-phenon |
| 2-<2-Diisopropylamino-aethoxy>-butyrophenon |
| 2-diethylaminoethyl 10H-phenothiazine-2-carboxylate |
| Ketocaine |