GPLGIAGQ
Modify Date: 2025-08-24 19:50:44
GPLGIAGQ structure
|
Common Name | GPLGIAGQ | ||
|---|---|---|---|---|
| CAS Number | 109053-09-0 | Molecular Weight | 711.81 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H53N9O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GPLGIAGQGPLGIAGQ, a MMP2-cleavable polypeptide, is used as a stimulus-sensitive linker in both liposomal and micellar nanocarriers for MMP2-triggered tumor targeting. GPLGIAGQ can be used to synthesis unique MMP2-targeted photosensitizer in photodynamic therapy (PDT)[1][2][3]. |
| Name | GPLGIAGQ |
|---|
| Description | GPLGIAGQ, a MMP2-cleavable polypeptide, is used as a stimulus-sensitive linker in both liposomal and micellar nanocarriers for MMP2-triggered tumor targeting. GPLGIAGQ can be used to synthesis unique MMP2-targeted photosensitizer in photodynamic therapy (PDT)[1][2][3]. |
|---|---|
| Related Catalog | |
| Target |
MMP2[1]. |
| In Vitro | GPLGIAGQ is used to trigger PEG deshielding of liposomal carriers, resulting in enhanced cellular internalization[3]. |
| References |
| Molecular Formula | C31H53N9O10 |
|---|---|
| Molecular Weight | 711.81 |
| InChIKey | BLNMYSBCIVAVFK-PFZXUFBWSA-N |
| SMILES | CCC(C)C(NC(=O)CNC(=O)C(CC(C)C)NC(=O)C1CCCN1C(=O)CN)C(=O)NC(C)C(=O)NCC(=O)NC(CCC(N)=O)C(=O)O |