8-QUINOLINYL TRIFLATE structure
|
Common Name | 8-QUINOLINYL TRIFLATE | ||
|---|---|---|---|---|
| CAS Number | 108530-08-1 | Molecular Weight | 277.22000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H6F3NO3S | Melting Point | 65-68ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | quinolin-8-yl trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 65-68ºC(lit.) |
|---|---|
| Molecular Formula | C10H6F3NO3S |
| Molecular Weight | 277.22000 |
| Exact Mass | 277.00200 |
| PSA | 64.64000 |
| LogP | 3.54400 |
| InChIKey | YUWOECMFUBVGSE-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Oc1cccc2cccnc12)C(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933499090 |
|
~99%
8-QUINOLINYL TR... CAS#:108530-08-1 |
| Literature: Zou, Yinjun; Qin, Liena; Ren, Xinfeng; Lu, Yunpeng; Li, Yongxin; Zhou, Jianrong Chemistry - A European Journal, 2013 , vol. 19, # 10 p. 3504 - 3511 |
| Precursor 2 | |
|---|---|
| DownStream 8 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Badone, D.; Guzzi, U.
Tetrahedron Lett. 34 , 3603, (1993)
|
| Methanesulfonic acid,1,1,1-trifluoro-,8-quinolinyl ester |
| 8-quinolyl trifluoromethanesulfonate |
| quinoline-8-yl trifluoromethanesulfonate |
| 8-quinolinyl triflate |
| quinolin-8-yltrifluoromethanesulfonate |
| 8-Quinolinyl trifluoromethanesulfonate |
| 8-trifluoromethanesulfonyloxyquinoline |
| 8-Quinolyl triflate |
| MFCD00274222 |