10,10-difluoroarachidonic acid structure
|
Common Name | 10,10-difluoroarachidonic acid | ||
|---|---|---|---|---|
| CAS Number | 108212-58-4 | Molecular Weight | 340.44800 | |
| Density | 1.005g/cm3 | Boiling Point | 459.9ºC at 760mmHg | |
| Molecular Formula | C20H30F2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232ºC | |
| Name | 10,10-difluoroicosa-5,8,11,14-tetraenoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.005g/cm3 |
|---|---|
| Boiling Point | 459.9ºC at 760mmHg |
| Molecular Formula | C20H30F2O2 |
| Molecular Weight | 340.44800 |
| Flash Point | 232ºC |
| Exact Mass | 340.22100 |
| PSA | 37.30000 |
| LogP | 6.46190 |
| Vapour Pressure | 9.78E-10mmHg at 25°C |
| Index of Refraction | 1.483 |
| InChIKey | GCPGXCVCWYWJAX-BQGGUJHBSA-N |
| SMILES | CCCCCC=CCC=CC(F)(F)C=CCC=CCCCC(=O)O |
| HS Code | 2916190090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 10,10-Difluoroarachidonic acid |