10,10-dioxophenoxathiine-4-carboxylic acid
Modify Date: 2024-04-01 17:28:21
10,10-dioxophenoxathiine-4-carboxylic acid structure
|
Common Name | 10,10-dioxophenoxathiine-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 5453-76-9 | Molecular Weight | 276.26500 | |
| Density | 1.567g/cm3 | Boiling Point | 530.9ºC at 760 mmHg | |
| Molecular Formula | C13H8O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.9ºC | |
| Name | 10,10-dioxophenoxathiine-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.567g/cm3 |
|---|---|
| Boiling Point | 530.9ºC at 760 mmHg |
| Molecular Formula | C13H8O5S |
| Molecular Weight | 276.26500 |
| Flash Point | 274.9ºC |
| Exact Mass | 276.00900 |
| PSA | 89.05000 |
| LogP | 3.40410 |
| Index of Refraction | 1.675 |
| InChIKey | CAEGKBNGCLRKAR-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc2c1Oc1ccccc1S2(=O)=O |
|
~%
10,10-dioxophen... CAS#:5453-76-9 |
| Literature: Gilman et al. Journal of the American Chemical Society, 1940 , vol. 62, p. 2606,2608 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HMS3095O08 |
| phenoxathiine-4-carboxylic acid 10,10-dioxide |