N-(2-nitrophenyl)-2-(4-oxoquinazolin-3-yl)acetamide structure
|
Common Name | N-(2-nitrophenyl)-2-(4-oxoquinazolin-3-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 108086-42-6 | Molecular Weight | 324.29100 | |
| Density | 1.44g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H12N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-nitrophenyl)-2-(4-oxoquinazolin-3-yl)acetamide |
|---|
| Density | 1.44g/cm3 |
|---|---|
| Molecular Formula | C16H12N4O4 |
| Molecular Weight | 324.29100 |
| Exact Mass | 324.08600 |
| PSA | 113.30000 |
| LogP | 3.11610 |
| Index of Refraction | 1.691 |
| InChIKey | DMOIRLHWICVFRH-UHFFFAOYSA-N |
| SMILES | O=C(Cn1cnc2ccccc2c1=O)Nc1ccccc1[N+](=O)[O-] |
|
~69%
N-(2-nitropheny... CAS#:108086-42-6 |
| Literature: Saksena, R. K.; Yasmeen, Rana Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1986 , vol. 25, p. 438 - 440 |
|
~%
N-(2-nitropheny... CAS#:108086-42-6 |
| Literature: Saksena, R. K.; Yasmeen, Rana Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1986 , vol. 25, p. 438 - 440 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |