Gliadorphin-7 trifluoroacetate salt
Modify Date: 2025-08-22 19:32:25
Gliadorphin-7 trifluoroacetate salt structure
|
Common Name | Gliadorphin-7 trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 107936-65-2 | Molecular Weight | 875.96600 | |
| Density | 1.383g/cm3 | Boiling Point | 1356ºC at 760mmHg | |
| Molecular Formula | C43H57N9O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 773.9ºC | |
Use of Gliadorphin-7 trifluoroacetate saltα-Gliadin (43-49) is the major protein component of gluten. α-Gliadin (43-49) can be used in the immunological response to α-gliadin[1]. |
| Name | Gliadorphin-7 |
|---|---|
| Synonym | More Synonyms |
| Description | α-Gliadin (43-49) is the major protein component of gluten. α-Gliadin (43-49) can be used in the immunological response to α-gliadin[1]. |
|---|---|
| Related Catalog | |
| In Vitro | α-Gliadin (43-49) inhibits the production of lymphokine activities by mononuclear leukocytes[1]. |
| References |
| Density | 1.383g/cm3 |
|---|---|
| Boiling Point | 1356ºC at 760mmHg |
| Molecular Formula | C43H57N9O11 |
| Molecular Weight | 875.96600 |
| Flash Point | 773.9ºC |
| Exact Mass | 875.41800 |
| PSA | 317.96000 |
| LogP | 1.63500 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | QGFISQMZJLWFEE-NXBWRCJVSA-N |
| SMILES | NC(=O)CCC(NC(=O)C1CCCN1C(=O)C(N)Cc1ccc(O)cc1)C(=O)N1CCCC1C(=O)NC(CCC(N)=O)C(=O)N1CCCC1C(=O)NC(Cc1ccccc1)C(=O)O |
| H-Tyr-Pro-Gln-Pro-Gln-Pro-Phe-OH |
| GD-7,ProlaMin (43-49),a/b-Gliadin (43-49) |