PF0998425
Modify Date: 2025-09-14 12:42:21
PF0998425 structure
|
Common Name | PF0998425 | ||
|---|---|---|---|---|
| CAS Number | 1076225-27-8 | Molecular Weight | 269.26200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14F3NO | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of PF0998425PF0998425 is a bioactive chemical. |
| Name | 4-[(1R,2R)-2-Hydroxycyclohexyl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14F3NO |
|---|---|
| Molecular Weight | 269.26200 |
| Exact Mass | 269.10300 |
| PSA | 44.02000 |
| LogP | 3.59558 |
| InChIKey | MENRRRXHFQYXDW-DGCLKSJQSA-N |
| SMILES | N#Cc1ccc(C2CCCCC2O)cc1C(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| Virodhamine |
| 4-((1R,2R)-2-Hydroxycyclohexyl)-2(trifluoromethyl)benzonitrile |