Diadenosine heptaphosphate
Modify Date: 2023-04-05 12:11:37
Diadenosine heptaphosphate structure
|
Common Name | Diadenosine heptaphosphate | ||
|---|---|---|---|---|
| CAS Number | 106597-55-1 | Molecular Weight | 1076.327 | |
| Density | 2.8±0.1 g/cm3 | Boiling Point | 1411.0±75.0 °C at 760 mmHg | |
| Molecular Formula | C20H31N10O28P7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 807.1±37.1 °C | |
| Name | Adenosine 5′-(octahydrogen heptaphosphate), P′′′′′′→5′-ester with adenosine |
|---|---|
| Synonym | More Synonyms |
| Density | 2.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 1411.0±75.0 °C at 760 mmHg |
| Molecular Formula | C20H31N10O28P7 |
| Molecular Weight | 1076.327 |
| Flash Point | 807.1±37.1 °C |
| Exact Mass | 1075.947266 |
| LogP | -8.92 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.962 |
| InChIKey | IBORMIZOWBHWTG-XPWFQUROSA-N |
| SMILES | Nc1ncnc2c1ncn2C1OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OCC2OC(n3cnc4c(N)ncnc43)C(O)C2O)C(O)C1O |
| Adenosine 5′-(octahydrogen heptaphosphate), P′′′′′′→5′-ester with adenosine |