2-methoxy-6-[[(4-methylpyridin-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one
Modify Date: 2025-09-21 17:01:17
![2-methoxy-6-[[(4-methylpyridin-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one Structure](https://image.chemsrc.com/caspic/465/106052-58-8.png)
2-methoxy-6-[[(4-methylpyridin-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one structure
|
Common Name | 2-methoxy-6-[[(4-methylpyridin-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 106052-58-8 | Molecular Weight | 242.27300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methoxy-6-[[(4-methylpyridin-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one |
|---|
| Molecular Formula | C14H14N2O2 |
|---|---|
| Molecular Weight | 242.27300 |
| Exact Mass | 242.10600 |
| PSA | 51.22000 |
| LogP | 2.42800 |
| InChIKey | GBXKQIQIVTZGLB-UHFFFAOYSA-N |
| SMILES | COc1cccc(C=Nc2cc(C)ccn2)c1O |
|
~%
2-methoxy-6-[[(... CAS#:106052-58-8 |
| Literature: Journal of the Indian Chemical Society, , vol. 89, # 3 p. 315 - 322 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |