1-thio-beta-d-glucose sodium salt structure
|
Common Name | 1-thio-beta-d-glucose sodium salt | ||
|---|---|---|---|---|
| CAS Number | 10593-29-0 | Molecular Weight | 218.203 | |
| Density | N/A | Boiling Point | 432.6ºC at 760 mmHg | |
| Molecular Formula | C6H11NaO5S | Melting Point | 173ºC | |
| MSDS | Chinese USA | Flash Point | 215.5ºC | |
| Name | 1-Thio-β-D-glucose Sodium Salt Dihydrate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 432.6ºC at 760 mmHg |
|---|---|
| Melting Point | 173ºC |
| Molecular Formula | C6H11NaO5S |
| Molecular Weight | 218.203 |
| Flash Point | 215.5ºC |
| Exact Mass | 218.022491 |
| PSA | 90.15000 |
| Vapour Pressure | 2.66E-09mmHg at 25°C |
| InChIKey | VKPBZIVFRYLHPT-WNFIKIDCSA-M |
| SMILES | OCC1OC([S-])C(O)C(O)C1O.[Na+] |
| Storage condition | −20°C |
| Water Solubility | Soluble in water |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 6-24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~%
1-thio-beta-d-g... CAS#:10593-29-0 |
| Literature: European Journal of Organic Chemistry, , # 5 p. 1143 - 1152 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 1-THIO-β-D-GLUCOSE SODIUM SALT |
| Sodium (2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-thiolate |
| β-D-Glucopyranose, 1-thio-, sodium salt (1:1) |