barium iodate structure
|
Common Name | barium iodate | ||
|---|---|---|---|---|
| CAS Number | 10567-69-8 | Molecular Weight | 487.13200 | |
| Density | 4.998 | Boiling Point | N/A | |
| Molecular Formula | BaI2O6 | Melting Point | 476(分解)ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | barium(2+),diiodate |
|---|---|
| Synonym | More Synonyms |
| Density | 4.998 |
|---|---|
| Melting Point | 476(分解)ºC |
| Molecular Formula | BaI2O6 |
| Molecular Weight | 487.13200 |
| Exact Mass | 487.68400 |
| PSA | 114.40000 |
| LogP | 1.05860 |
| InChIKey | GASILTKHXWGKMG-UHFFFAOYSA-L |
| SMILES | [Ba+2].[O-][I+2]([O-])[O-].[O-][I+2]([O-])[O-] |
| Stability | Stable. Oxidizer - contact with combustible material may cause fire. Incompatible with reducing agents, easily oxidized materials, organics. Non-flammable. |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R20/22 |
| Safety Phrases | S28 |
| RIDADR | UN 3087 5.1/PG 2 |
| WGK Germany | 1 |
| Packaging Group | II |
| Hazard Class | 5.1 |
| barium(2+) diiodate |
| Barium iodate |
| EINECS 234-152-6 |
| Iodic acid (HIO3),barium salt |
| MFCD00239354 |
| barium diiodate |