HAT-CN structure
|
Common Name | HAT-CN | ||
|---|---|---|---|---|
| CAS Number | 105598-27-4 | Molecular Weight | 384.273 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 988.7±65.0 °C at 760 mmHg | |
| Molecular Formula | C18N12 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 247.4±19.5 °C | |
| Name | Dipyrazino[2,3-f:2',3'-h]quinoxaline-2,3,6,7,10,11-hexacarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 988.7±65.0 °C at 760 mmHg |
| Molecular Formula | C18N12 |
| Molecular Weight | 384.273 |
| Flash Point | 247.4±19.5 °C |
| Exact Mass | 384.036896 |
| PSA | 220.08000 |
| LogP | -0.36 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.873 |
| InChIKey | DKHNGUNXLDCATP-UHFFFAOYSA-N |
| SMILES | N#Cc1nc2c3nc(C#N)c(C#N)nc3c3nc(C#N)c(C#N)nc3c2nc1C#N |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
|
~82%
HAT-CN CAS#:105598-27-4 |
| Literature: Kanakarajan, K.; Czarnik, Anthony W. Journal of Organic Chemistry, 1986 , vol. 51, # 26 p. 5241 - 5243 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Synt. Metals 3-4th ed., 162 , 402-405, (2012)
|
|
|
Appl. Phys. Lett. 4th ed., 99 , 043308/1-043308/3, (2011)
|
| 1,4,5,8,9,12-Hexaaza-triphenylene-2,3,6,7,10,11-hexacarbonitrile |
| hexaazatriphenylene(CN)6 |
| hexaazatriphenylenehexacarbonitrile |
| X1021 |
| 2,3,6,7,10,11-hexacyanohexaazatriphenylene |
| 2,3,6,7,10,11-hexacyano-1,4,5,8,9,12-hexaazatriphenylene |
| Dipyrazino[2,3-f:2',3'-h]quinoxaline-2,3,6,7,10,11-hexacarbonitrile |
| 1,4,5,8,9,12-hexaazatriphenylenehexacarbonitrile |
| HAT-CN |