D-Phenylalanine,N-(2,4-dinitrophenyl)- structure
|
Common Name | D-Phenylalanine,N-(2,4-dinitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 10549-12-9 | Molecular Weight | 331.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2,4-dinitroanilino)-3-phenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H13N3O6 |
|---|---|
| Molecular Weight | 331.28000 |
| Exact Mass | 331.08000 |
| PSA | 140.97000 |
| LogP | 3.73020 |
| InChIKey | HJQHTLAEPSKXQJ-UHFFFAOYSA-N |
| SMILES | O=C(O)C(Cc1ccccc1)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
|
~91%
D-Phenylalanine... CAS#:10549-12-9 |
| Literature: Risch, Nikolaus; Koester, Bettina; Schormann, Anette; Siemens, Thomas; Brockmann, Hans Liebigs Annalen der Chemie, 1988 , p. 343 - 348 |
|
~%
D-Phenylalanine... CAS#:10549-12-9 |
| Literature: Mitulovi, Goran; Laemmerhofer, Michael; Maier; Lindner, Wolfgang Journal of Labelled Compounds and Radiopharmaceuticals, 2000 , vol. 43, # 5 p. 449 - 461 |
| N-2,4-Dinitrobenzol-phthalimid |
| N-2,4-Dinitrophenyl-D-phenylalanin |