1-N-Boc-1-hydrazinoacetaldehyde diethyl acetal structure
|
Common Name | 1-N-Boc-1-hydrazinoacetaldehyde diethyl acetal | ||
|---|---|---|---|---|
| CAS Number | 1053659-75-8 | Molecular Weight | 248.31900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H24N2O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | tert-butyl N-amino-N-(1,1-diethoxyethyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H24N2O4 |
|---|---|
| Molecular Weight | 248.31900 |
| Exact Mass | 248.17400 |
| PSA | 74.02000 |
| LogP | 2.54420 |
| InChIKey | CNGTWHVGDGACIE-UHFFFAOYSA-N |
| SMILES | CCOC(C)(OCC)N(N)C(=O)OC(C)(C)C |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H319 |
| Precautionary Statements | P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| RIDADR | UN 2810 6.1 / PGIII |
| HS Code | 2928000090 |
| Flash Point(F) | >230 °F |
| Flash Point(C) | >110 °C |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 1-N-Boc-1-hydrazinoacetaldehyde diethyl acetal |