2-(4-chlorophenyl)-4,5-dimethyl-3,6-dihydrooxazine structure
|
Common Name | 2-(4-chlorophenyl)-4,5-dimethyl-3,6-dihydrooxazine | ||
|---|---|---|---|---|
| CAS Number | 105207-76-9 | Molecular Weight | 223.69900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-chlorophenyl)-4,5-dimethyl-3,6-dihydrooxazine |
|---|
| Molecular Formula | C12H14ClNO |
|---|---|
| Molecular Weight | 223.69900 |
| Exact Mass | 223.07600 |
| PSA | 12.47000 |
| LogP | 3.49300 |
| InChIKey | RVHRFPNLPAZJIL-UHFFFAOYSA-N |
| SMILES | CC1=C(C)CN(c2ccc(Cl)cc2)OC1 |
|
~%
2-(4-chlorophen... CAS#:105207-76-9 |
| Literature: Ragaini, Fabio; Cenini, Sergio; Brignoli, Daniela; Gasperini, Michela; Gallo, Emma Journal of Organic Chemistry, 2003 , vol. 68, # 2 p. 460 - 466 |
|
~50%
2-(4-chlorophen... CAS#:105207-76-9 |
| Literature: Moller, Eval Rud; Jorgensen, Karl Anker Journal of Organic Chemistry, 1996 , vol. 61, # 17 p. 5770 - 5778 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |