4,6-Bis-(trichloromethyl)-2-(4-chlorophenyl)-1,3,5-triazine structure
|
Common Name | 4,6-Bis-(trichloromethyl)-2-(4-chlorophenyl)-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 3712-60-5 | Molecular Weight | 426.34100 | |
| Density | 1.712g/cm3 | Boiling Point | 452.5ºC at 760mmHg | |
| Molecular Formula | C11H4Cl7N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260ºC | |
| Name | 2-(4-chlorophenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.712g/cm3 |
|---|---|
| Boiling Point | 452.5ºC at 760mmHg |
| Molecular Formula | C11H4Cl7N3 |
| Molecular Weight | 426.34100 |
| Flash Point | 260ºC |
| Exact Mass | 422.82200 |
| PSA | 38.67000 |
| LogP | 5.84540 |
| Index of Refraction | 1.625 |
| InChIKey | WJKHYAJKIXYSHS-UHFFFAOYSA-N |
| SMILES | Clc1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 2-(p-chlorophenyl)-4,6-bis(trichloromethyl)-s-triazine |
| 2-(p-chlorophenyl)-4,5-diphenylimidazole |
| 2,4-Bis(trichlormethyl)-6-(p-chlorphenyl)-1,3,5-triazin |
| 2-(4-chlorophenyl)-4,5-diphenylimidazole |
| 4-Cl-lophine |
| 2-(4-chlorophenyl)-4,5-dimethyl-3,6-dihydro-2H-[1,2]oxazine |
| 2-(4-chloro-phenyl)-4,6-bis-trichloromethyl-[1,3,5]triazine |
| 2-(4'-chlorophenyl)-4,5-diphenyl-1H-imidazole |
| 2H-1,2-Oxazine,2-(4-chlorophenyl)-3,6-dihydro-4,5-dimethyl |
| 2-(4-Chlor-phenyl)-4,5-dimethyl-3,6-dihydro-2H-[1,2]oxazin |