H-Gly-Asp-Gly-OH structure
|
Common Name | H-Gly-Asp-Gly-OH | ||
|---|---|---|---|---|
| CAS Number | 10517-27-8 | Molecular Weight | 247.20500 | |
| Density | 1.491g/cm3 | Boiling Point | 746.5ºC at 760 mmHg | |
| Molecular Formula | C8H13N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 405.3ºC | |
Use of H-Gly-Asp-Gly-OHH-Gly-Asp-Gly-OH is a biologically active peptide. |
| Name | h-gly-asp-gly-oh |
|---|
| Description | H-Gly-Asp-Gly-OH is a biologically active peptide. |
|---|---|
| Related Catalog | |
| References |
[1]. Birnbaum S, et al. Peptide screening. Current Opinion in Biotechnology, 1992, 3(1): 49-54. |
| Density | 1.491g/cm3 |
|---|---|
| Boiling Point | 746.5ºC at 760 mmHg |
| Molecular Formula | C8H13N3O6 |
| Molecular Weight | 247.20500 |
| Flash Point | 405.3ºC |
| Exact Mass | 247.08000 |
| PSA | 158.82000 |
| Vapour Pressure | 2.2E-24mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | SUENNJKZJSVCKD-BYPYZUCNSA-N |
| SMILES | NCC(=O)NC(CC(=O)O)C(=O)NCC(=O)O |