5-amino-2-(trifluoromethoxy)benzotrifluoride
Modify Date: 2025-09-10 19:48:25
5-amino-2-(trifluoromethoxy)benzotrifluoride structure
|
Common Name | 5-amino-2-(trifluoromethoxy)benzotrifluoride | ||
|---|---|---|---|---|
| CAS Number | 104678-68-4 | Molecular Weight | 245.12200 | |
| Density | 1.48g/cm3 | Boiling Point | 209.3ºC at 760mmHg | |
| Molecular Formula | C8H5F6NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 80.4ºC | |
| Name | 4-(trifluoromethoxy)-3-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 209.3ºC at 760mmHg |
| Molecular Formula | C8H5F6NO |
| Molecular Weight | 245.12200 |
| Flash Point | 80.4ºC |
| Exact Mass | 245.02800 |
| PSA | 35.25000 |
| LogP | 3.76740 |
| Vapour Pressure | 0.205mmHg at 25°C |
| Index of Refraction | 1.427 |
| InChIKey | ZXYQQLFHWWMQHL-UHFFFAOYSA-N |
| SMILES | Nc1ccc(OC(F)(F)F)c(C(F)(F)F)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2922199090 |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD04972664 |