Leucokinin I
Modify Date: 2025-09-05 22:28:06
Leucokinin I structure
|
Common Name | Leucokinin I | ||
|---|---|---|---|---|
| CAS Number | 104600-89-7 | Molecular Weight | 891.92600 | |
| Density | 1.42g/cm3 | Boiling Point | 1513.4ºC at 760mmHg | |
| Molecular Formula | C41H53N11O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 869.1ºC | |
Use of Leucokinin ILeucokinin I is a peptide that stimulates contraction of the anterior midgut and hindgut muscles involved in feeding in Rhodnius prolixus but not absorption in the anterior midgut[1]. |
| Name | Leucokinin I |
|---|
| Description | Leucokinin I is a peptide that stimulates contraction of the anterior midgut and hindgut muscles involved in feeding in Rhodnius prolixus but not absorption in the anterior midgut[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 1513.4ºC at 760mmHg |
| Molecular Formula | C41H53N11O12 |
| Molecular Weight | 891.92600 |
| Flash Point | 869.1ºC |
| Exact Mass | 891.38800 |
| PSA | 380.43000 |
| LogP | 0.04340 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | ADMFWPBDASJZNU-SKHNUPMMSA-N |
| SMILES | CC(NC(=O)C1CCCN1C(=O)C(N)CC(=O)O)C(=O)NC(Cc1ccccc1)C(=O)NC(CC(N)=O)C(=O)NC(CO)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NCC(N)=O |