6-(Propoxymethyl)-2,4-pteridinediamine structure
|
Common Name | 6-(Propoxymethyl)-2,4-pteridinediamine | ||
|---|---|---|---|---|
| CAS Number | 104438-50-8 | Molecular Weight | 234.25800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(propoxymethyl)pteridine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H14N6O |
|---|---|
| Molecular Weight | 234.25800 |
| Exact Mass | 234.12300 |
| PSA | 112.83000 |
| LogP | 1.67320 |
| InChIKey | RSDZHSCZDVWULS-UHFFFAOYSA-N |
| SMILES | CCCOCc1cnc2nc(N)nc(N)c2n1 |
| HS Code | 2933990090 |
|---|
|
~64%
6-(Propoxymethy... CAS#:104438-50-8 |
| Literature: Journal of Medicinal Chemistry, , vol. 30, # 1 p. 40 - 45 |
|
~%
6-(Propoxymethy... CAS#:104438-50-8 |
| Literature: Journal of Medicinal Chemistry, , vol. 30, # 1 p. 40 - 45 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-(PROPOXYMETHYL)-2,4-PTERIDINEDIAMINE |
| 2,4-Pteridinediamine,6-(propoxymethyl) |
| 2,4-Diamino-6-n-propoxymethylpteridine |