6-Deoxypenciclovir structure
|
Common Name | 6-Deoxypenciclovir | ||
|---|---|---|---|---|
| CAS Number | 104227-86-3 | Molecular Weight | 237.25800 | |
| Density | 1.55 g/cm3 | Boiling Point | 594.3ºC at 760 mmHg | |
| Molecular Formula | C10H15N5O2 | Melting Point | 156-158ºC | |
| MSDS | N/A | Flash Point | 313.2ºC | |
| Name | 6-Deoxypenciclovir |
|---|---|
| Synonym | More Synonyms |
| Density | 1.55 g/cm3 |
|---|---|
| Boiling Point | 594.3ºC at 760 mmHg |
| Melting Point | 156-158ºC |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.25800 |
| Flash Point | 313.2ºC |
| Exact Mass | 237.12300 |
| PSA | 110.08000 |
| Vapour Pressure | 5.73E-15mmHg at 25°C |
| Index of Refraction | 1.718 |
| InChIKey | WJOWACPJSFGNRM-UHFFFAOYSA-N |
| SMILES | Nc1ncc2ncn(CCC(CO)CO)c2n1 |
| Storage condition | -20°C |
| HS Code | 2933990090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-[2-(2-aminopurin-9-yl)ethyl]propane-1,3-diol |
| 2-[2-(2-Amino-9H-Purin-9-Yl)Ethyl]-1,3-Propanediol |
| Famciclovir Impurity 2 |