2,4,5-Trifluoro-3-bromobenzoic acid
Modify Date: 2025-08-23 10:19:23
2,4,5-Trifluoro-3-bromobenzoic acid structure
|
Common Name | 2,4,5-Trifluoro-3-bromobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 104222-42-6 | Molecular Weight | 254.989 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | 285.9±40.0 °C at 760 mmHg | |
| Molecular Formula | C7H2BrF3O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 126.7±27.3 °C | |
| Name | 3-Bromo-2,4,5-trifluorobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 285.9±40.0 °C at 760 mmHg |
| Molecular Formula | C7H2BrF3O2 |
| Molecular Weight | 254.989 |
| Flash Point | 126.7±27.3 °C |
| Exact Mass | 253.919022 |
| PSA | 37.30000 |
| LogP | 2.95 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | VWVLSESGZBAPHA-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(F)c(F)c(Br)c1F |
|
~46%
2,4,5-Trifluoro... CAS#:104222-42-6 |
| Literature: Renau, Thomas E.; Sanchez, Joseph P.; Domagala, John M. Journal of Heterocyclic Chemistry, 1996 , vol. 33, # 4 p. 1407 - 1411 |
|
~%
2,4,5-Trifluoro... CAS#:104222-42-6 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 33, # 4 p. 1407 - 1411 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid, 3-bromo-2,4,5-trifluoro- |
| 3-BROMO-2,4,5-TRIFLUOROBENZOICACID |
| 2,4,5-Trifluoro-3-bromobenzoic acid |
| ALPHA-PYRROLIDONE |
| BENZOIC ACID,3-BROMO-2,4,5-TRIFLUORO- |
| 3-CHLORO-2,4,5-TRIFLUOROBENZOIC ACID |
| MFCD05664065 |
| 3-Bromo-2,4,5-trifluorobenzoic acid |