5-(dimethylamino)-2-phenyl-2-propan-2-ylpentanamide structure
|
Common Name | 5-(dimethylamino)-2-phenyl-2-propan-2-ylpentanamide | ||
|---|---|---|---|---|
| CAS Number | 10404-36-1 | Molecular Weight | 262.39000 | |
| Density | 0.995g/cm3 | Boiling Point | 426.5ºC at 760 mmHg | |
| Molecular Formula | C16H26N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.8ºC | |
| Name | 5-(dimethylamino)-2-phenyl-2-propan-2-ylpentanamide |
|---|
| Density | 0.995g/cm3 |
|---|---|
| Boiling Point | 426.5ºC at 760 mmHg |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.39000 |
| Flash Point | 211.8ºC |
| Exact Mass | 262.20500 |
| PSA | 47.32000 |
| LogP | 3.55720 |
| Vapour Pressure | 1.76E-07mmHg at 25°C |
| Index of Refraction | 1.516 |
| InChIKey | VNEUUVINIIKERW-UHFFFAOYSA-N |
| SMILES | CC(C)C(CCCN(C)C)(C(N)=O)c1ccccc1 |
|
~%
5-(dimethylamin... CAS#:10404-36-1 |
| Literature: Pala,G. et al. Journal of Medicinal Chemistry, 1966 , vol. 9, p. 786 - 788 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |