5-Chloro-6-oxo-1,6-dihydropyridine-2-carboxylic acid structure
|
Common Name | 5-Chloro-6-oxo-1,6-dihydropyridine-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 103997-21-3 | Molecular Weight | 173.554 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 375.4±42.0 °C at 760 mmHg | |
| Molecular Formula | C6H4ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.9±27.9 °C | |
| Name | 5-chloro-6-oxo-1H-pyridine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 375.4±42.0 °C at 760 mmHg |
| Molecular Formula | C6H4ClNO3 |
| Molecular Weight | 173.554 |
| Flash Point | 180.9±27.9 °C |
| Exact Mass | 172.987976 |
| PSA | 70.42000 |
| LogP | -0.61 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | GJCDETCQSYSYFT-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(Cl)c(=O)[nH]1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Chloro-6-oxo-1,6-dihydropyridine-2-carboxylic acid |
| 5-Chloro-6-oxo-1,6-dihydro-2-pyridinecarboxylic acid |
| 2-pyridinecarboxylic acid, 5-chloro-6-hydroxy- |
| 5-chloro-6-hydroxy picolinic acid |
| 2-Pyridinecarboxylic acid, 5-chloro-1,6-dihydro-6-oxo- |
| 5-Chloro-6-hydroxypyridine-2-carboxylic acid |