5,5'-Methylenediisophthalic Acid structure
|
Common Name | 5,5'-Methylenediisophthalic Acid | ||
|---|---|---|---|---|
| CAS Number | 10397-52-1 | Molecular Weight | 344.27200 | |
| Density | 1.572±0.06 | Boiling Point | 729.5±60.0 °C | |
| Molecular Formula | C17H12O8 | Melting Point | 324-331°C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | 3,3′,5,5′-Tetracarboxydiphenylmethane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.572±0.06 |
|---|---|
| Boiling Point | 729.5±60.0 °C |
| Melting Point | 324-331°C |
| Molecular Formula | C17H12O8 |
| Molecular Weight | 344.27200 |
| Exact Mass | 344.05300 |
| PSA | 149.20000 |
| LogP | 2.07020 |
| InChIKey | RAESDWWKTFZWJA-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(Cc2cc(C(=O)O)cc(C(=O)O)c2)cc(C(=O)O)c1 |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H317-H400 |
| Precautionary Statements | P273-P280 |
| Hazard Codes | Xi,N |
| Safety Phrases | 36/37-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| Hazard Class | 43-50 |
| HS Code | 2917399090 |
|
~93%
5,5'-Methylened... CAS#:10397-52-1 |
| Literature: Technische Universitaet Carolo-Wilhelmina zu Braunschweig Patent: EP1972338 A1, 2008 ; Location in patent: Page/Page column 16 ; |
|
~%
5,5'-Methylened... CAS#:10397-52-1 |
| Literature: Technische Universitaet Carolo-Wilhelmina zu Braunschweig Patent: EP1972338 A1, 2008 ; Location in patent: Page/Page column 15-16 ; |
|
~%
5,5'-Methylened... CAS#:10397-52-1 |
| Literature: Mazik, Monika; Koenig, Alexander European Journal of Organic Chemistry, 2007 , # 20 p. 3271 - 3276 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Enhancing H2 uptake by "close-packing" alignment of open copper sites in metal-organic frameworks.
Angew. Chem. Int. Ed. Engl. 47 , 7263, (2008)
|
| 5-[(3,5-dicarboxyphenyl)methyl]benzene-1,3-dicarboxylic acid |
| 5,5’-Methylenediisophthalic Acid |
| Linker for PCN-12 MOF |