Moexiprilat
Modify Date: 2025-08-25 20:15:02
Moexiprilat structure
|
Common Name | Moexiprilat | ||
|---|---|---|---|---|
| CAS Number | 103775-14-0 | Molecular Weight | 470.51500 | |
| Density | 1.284g/cm3 | Boiling Point | 717.4ºC at 760mmHg | |
| Molecular Formula | C25H30N2O7 | Melting Point | 145-170ºC | |
| MSDS | N/A | Flash Point | 387.7ºC | |
Use of MoexiprilatMoexiprilat completely inhibits estrone-induced cardiac fibroblast growth. |
| Name | Moexiprilat |
|---|---|
| Synonym | More Synonyms |
| Density | 1.284g/cm3 |
|---|---|
| Boiling Point | 717.4ºC at 760mmHg |
| Melting Point | 145-170ºC |
| Molecular Formula | C25H30N2O7 |
| Molecular Weight | 470.51500 |
| Flash Point | 387.7ºC |
| Exact Mass | 470.20500 |
| PSA | 125.40000 |
| LogP | 2.43460 |
| Vapour Pressure | 1.34E-21mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | CMPAGYDKASJORH-YSSFQJQWSA-N |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)C(C)NC(CCc1ccccc1)C(=O)O)C(C(=O)O)C2 |
| RIDADR | NONH for all modes of transport |
|---|
|
~79%
Moexiprilat CAS#:103775-14-0 |
| Literature: Klutchko; Blankley; Fleming; Hinkley; Werner; Nordin; Holmes; Hoefle; Cohen; Essenburg Journal of Medicinal Chemistry, 1986 , vol. 29, # 10 p. 1953 - 1961 |
|
~%
Moexiprilat CAS#:103775-14-0 |
| Literature: Klutchko; Blankley; Fleming; Hinkley; Werner; Nordin; Holmes; Hoefle; Cohen; Essenburg Journal of Medicinal Chemistry, 1986 , vol. 29, # 10 p. 1953 - 1961 |
![[3S-[2[R*(R*)]],3R*]-2-[2-[[1-(ethoxycarbonyl)-3-phenylpropyl]amino]-1-oxopropyl]-1,2,3,4-tetrahydro-6,7-dimethoxy-3-isoquinolinecarboxylic acid, phenylmethyl ester, hydrochloride structure](https://image.chemsrc.com/caspic/059/82586-51-4.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (3S)-2-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]propanoyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |