Pycnophorin
Modify Date: 2025-08-27 18:57:10
Pycnophorin structure
|
Common Name | Pycnophorin | ||
|---|---|---|---|---|
| CAS Number | 103630-05-3 | Molecular Weight | 428.60400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H40O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PycnophorinPycnophorin significantly inhibits the growth of Bacillus subtilis and Staphyloccocus aureus with equal minimum inhibitory concentration (MIC) values of 25 μM. |
| Name | pycnophorin |
|---|---|
| Synonym | More Synonyms |
| Description | Pycnophorin significantly inhibits the growth of Bacillus subtilis and Staphyloccocus aureus with equal minimum inhibitory concentration (MIC) values of 25 μM. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C27H40O4 |
|---|---|
| Molecular Weight | 428.60400 |
| Exact Mass | 428.29300 |
| PSA | 67.51000 |
| LogP | 6.43300 |
| InChIKey | FPYZZNAGOQEQIN-LQMNMMRTSA-N |
| SMILES | CC(C)=CCCC1C(=O)CCC2CC(C)(CCc3c(O)c(C)c(C)oc3=O)CCC21C |
| 3-{2-[(2R,4aS,5R,8aS)-2,4a-Dimethyl-5-(4-methyl-pent-3-enyl)-6-oxo-decahydro-naphthalen-2-yl]-ethyl}-4-hydroxy-5,6-dimethyl-pyran-2-one |