8-Bromo-1H-purine-2,6(3H,7H)-dione
Modify Date: 2025-09-15 19:04:41
8-Bromo-1H-purine-2,6(3H,7H)-dione structure
|
Common Name | 8-Bromo-1H-purine-2,6(3H,7H)-dione | ||
|---|---|---|---|---|
| CAS Number | 10357-68-3 | Molecular Weight | 231.007 | |
| Density | 2.1±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C5H3BrN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-Bromo-1H-purine-2,6(3H,7H)-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 2.1±0.1 g/cm3 |
|---|---|
| Molecular Formula | C5H3BrN4O2 |
| Molecular Weight | 231.007 |
| Exact Mass | 229.943924 |
| PSA | 94.40000 |
| LogP | -0.78 |
| Index of Refraction | 1.675 |
| InChIKey | ZFQWSCZYQLPFFZ-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(=O)c2[nH]c(Br)nc2[nH]1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~%
8-Bromo-1H-puri... CAS#:10357-68-3 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 221, p. 344 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-purine-2,6-dione, 8-bromo-3,9-dihydro- |
| 8-bromo-3,7-dihydropurine-2,6-dione |
| 8-Bromo-3,7-dihydro-1H-purine-2,6-dione |
| Xanthine, 8-bromo- |
| 1H-Purine-2,6-dione, 8-bromo-3,7-dihydro- |
| 8-Bromo-3,9-dihydro-1H-purine-2,6-dione |
| 8-bromoxanthine |