4-Ethyl-3-nitrobenzoic acid structure
|
Common Name | 4-Ethyl-3-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 103440-95-5 | Molecular Weight | 195.172 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 335.7±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.7±14.4 °C | |
| Name | 4-Ethyl-3-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 335.7±35.0 °C at 760 mmHg |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.172 |
| Flash Point | 147.7±14.4 °C |
| Exact Mass | 195.053162 |
| PSA | 83.12000 |
| LogP | 2.81 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | DUTYVLOGZGRKMA-UHFFFAOYSA-N |
| SMILES | CCc1ccc(C(=O)O)cc1[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2916399090 |
|
~96%
4-Ethyl-3-nitro... CAS#:103440-95-5 |
| Literature: WO2004/46107 A1, ; Page 187 ; WO 2004/046107 A1 |
|
~%
4-Ethyl-3-nitro... CAS#:103440-95-5 |
| Literature: WO2013/117649 A1, ; Paragraph 00331-00332 ; |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid, 4-ethyl-3-nitro- |
| 4-Ethyl-3-nitrobenzoic acid |