PTIQ
Modify Date: 2025-08-26 08:21:32
PTIQ structure
|
Common Name | PTIQ | ||
|---|---|---|---|---|
| CAS Number | 1032822-42-6 | Molecular Weight | 235.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PTIQPTIQ can suppress MMP-3 production, can enter the brain and provide neuroprotection. PTIQ has anti-inflammatory effects on microglial cells[1]. |
| Name | 2-ethylcarbonyl-7-hydroxy-6-methoxy-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| Synonym | More Synonyms |
| Description | PTIQ can suppress MMP-3 production, can enter the brain and provide neuroprotection. PTIQ has anti-inflammatory effects on microglial cells[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C13H17NO3 |
|---|---|
| Molecular Weight | 235.27900 |
| Exact Mass | 235.12100 |
| PSA | 49.77000 |
| LogP | 1.63340 |
| InChIKey | BEDYMEDICHGLSE-UHFFFAOYSA-N |
| SMILES | CCC(=O)N1CCc2cc(OC)c(O)cc2C1 |
| N-ethylcarbonyl-7-hydroxy-6-methoxy-1,2,3,4-tetrahydroisoquinoline |
| EHMTIQ |
| DMP 543 |
| PTIQ |