dialifos structure
|
Common Name | dialifos | ||
|---|---|---|---|---|
| CAS Number | 10311-84-9 | Molecular Weight | 393.84600 | |
| Density | 1.435g/cm3 | Boiling Point | 465.9ºC at 760mmHg | |
| Molecular Formula | C14H17ClNO4PS2 | Melting Point | 67-69ºC | |
| MSDS | Chinese USA | Flash Point | 100 °C | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
| Name | dialifos |
|---|---|
| Synonym | More Synonyms |
| Density | 1.435g/cm3 |
|---|---|
| Boiling Point | 465.9ºC at 760mmHg |
| Melting Point | 67-69ºC |
| Molecular Formula | C14H17ClNO4PS2 |
| Molecular Weight | 393.84600 |
| Flash Point | 100 °C |
| Exact Mass | 393.00300 |
| PSA | 123.04000 |
| LogP | 4.46670 |
| Vapour Pressure | 7.38E-09mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | MUMQYXACQUZOFP-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)SC(CCl)N1C(=O)c2ccccc2C1=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H300-H311-H410 |
| Precautionary Statements | P264-P273-P280-P301 + P310-P312-P501 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T+,N |
| Risk Phrases | 24-28-50/53 |
| Safety Phrases | 28-36/37-45-60-61 |
| RIDADR | 2783 |
| WGK Germany | 3 |
| RTECS | TD5165000 |
| Packaging Group | I |
| Hazard Class | 6.1(a) |
| HS Code | 2933990011 |
| HS Code | 2933990011 |
|---|---|
| Summary | 2933990011 o,o-diethyl o-quinoxalin-2-yl phosphorothioate。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:20.0% |
|
Effect of insecticides (Dimiline WP 25, Torak EC 24 and Gamacide 20) on hydra (Hydra vulgaris Pallas).
Int. J. Dev. Biol. 35(3) , 335-40, (1991) Investigations showed that the three insecticides used had the most damaging effect upon hydra immediately after treatment. The tentacles and the hypostome are the parts most often damaged. Inse the a... |
|
|
Pancuronium improves the neuromuscular transmission defect of human organophosphate intoxication.
Neurology 40(8) , 1275-7, (1990) Two patients with acute severe organophosphate intoxication showed (1) single evoked compound muscle action potentials (CMAP) with repetitive discharges and (2) prominent decremental responses of CMAP... |
|
|
Environmental fate of dialifor and formation of its oxygen analogue following application on grape vines in the San Joaquin Valley, California.
J. Agric. Food Chem. 28(6) , 1078-83, (1980)
|
| EINECS 233-689-3 |
| S-(2-chloro-1-phthalimidoethyl)-O,O-diethyldithiophosphate |
| O,O-diethyl S-(2-chloro-1-phthalimidoethyl)phosphorodithioate |
| Dialiphos [ISO-French] |
| rac-S-[(1R)-2-chloro-1-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)ethyl] O,O-diethyl phosphorodithioate |
| MFCD00055503 |
| N-[(RS)-2-chloro-1-(diethoxyphosphinothioylthio)ethyl]phthalimide |
| Torak |
| Dialifos |
| S-(RS)-2-chloro-1-phthalimidoethyl O,O-diethyl phosphorodithioate |
| 2-(2-chloro-1-diethoxyphosphinothioylsulfanylethyl)isoindole-1,3-dione |
| Dialiphor |
| Dialiphos |
| Caswell No. 280A |
| S-[2-chloro-1-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethyl] O,O-diethyl phosphorodithioate |
| dialifor |
| Dialifor [ANSI:BSI:ISO] |