2-(5-bromo-2-methylbenzyl)-5-(4-fluorophenyl)thiophene structure
|
Common Name | 2-(5-bromo-2-methylbenzyl)-5-(4-fluorophenyl)thiophene | ||
|---|---|---|---|---|
| CAS Number | 1030825-20-7 | Molecular Weight | 361.271 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 438.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C18H14BrFS | Melting Point | 103 °C | |
| MSDS | N/A | Flash Point | 218.9±27.3 °C | |
| Name | 2-[(5-bromo-2-methylphenyl)methyl]-5-(4-fluorophenyl)thiophene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 438.3±40.0 °C at 760 mmHg |
| Melting Point | 103 °C |
| Molecular Formula | C18H14BrFS |
| Molecular Weight | 361.271 |
| Flash Point | 218.9±27.3 °C |
| Exact Mass | 359.998352 |
| PSA | 28.24000 |
| LogP | 6.93 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | VLRIERSBZHUCOW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Br)cc1Cc1ccc(-c2ccc(F)cc2)s1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934999090 |
|
~76%
2-(5-bromo-2-me... CAS#:1030825-20-7 |
| Literature: Nomura, Sumihiro; Sakamaki, Shigeki; Hongu, Mitsuya; Kawanishi, Eiji; Koga, Yuichi; Sakamoto, Toshiaki; Yamamoto, Yasuo; Ueta, Kiichiro; Kimata, Hirotaka; Nakayama, Keiko; Tsuda-Tsukimoto, Minoru Journal of Medicinal Chemistry, 2010 , vol. 53, # 17 p. 6355 - 6360 |
|
~%
2-(5-bromo-2-me... CAS#:1030825-20-7 |
| Literature: WO2012/160218 A1, ; WO 2012/160218 A1 |
|
~%
2-(5-bromo-2-me... CAS#:1030825-20-7 |
| Literature: WO2012/160218 A1, ; WO 2012/160218 A1 |
|
~%
2-(5-bromo-2-me... CAS#:1030825-20-7 |
| Literature: WO2012/160218 A1, ; WO 2012/160218 A1 |
|
~%
2-(5-bromo-2-me... CAS#:1030825-20-7 |
| Literature: WO2012/160218 A1, ; WO 2012/160218 A1 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(5-Bromo-2-methylbenzyl)-5-(4-fluorophenyl)thiophene |
| Canagliflozin intermediate |
| Thiophene, 2-[(5-bromo-2-methylphenyl)methyl]-5-(4-fluorophenyl)- |
| 2-((5-bromo-2-methylphenyl)methyl)-5-(4-fluorophenyl)thiophene |