1,4-Benzenediamine,N1,N4-bis(1-methylheptyl)- structure
|
Common Name | 1,4-Benzenediamine,N1,N4-bis(1-methylheptyl)- | ||
|---|---|---|---|---|
| CAS Number | 103-96-8 | Molecular Weight | 332.56600 | |
| Density | 0.923g/cm3 | Boiling Point | 456.4ºC at 760mmHg | |
| Molecular Formula | C22H40N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.5ºC | |
| Name | 1-N,4-N-di(octan-2-yl)benzene-1,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.923g/cm3 |
|---|---|
| Boiling Point | 456.4ºC at 760mmHg |
| Molecular Formula | C22H40N2 |
| Molecular Weight | 332.56600 |
| Flash Point | 257.5ºC |
| Exact Mass | 332.31900 |
| PSA | 24.06000 |
| LogP | 7.37420 |
| Vapour Pressure | 1.63E-08mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | APTGHASZJUAUCP-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C)Nc1ccc(NC(C)CCCCCC)cc1 |
| HS Code | 2921519090 |
|---|
|
~%
1,4-Benzenediam... CAS#:103-96-8 |
| Literature: Universal Oil Prod.Co. Patent: US2883362 , 1953 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921519090 |
|---|---|
| Summary | 2921519090. o-, m-, p-phenylenediamine, diaminotoluenes, and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:17.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-bis-(1-methylheptyl)-1,4-phenylenediamine |
| DI-2-OCTYL-P-PHENYLENEDIAMINE |
| EINECS 203-162-2 |
| N,N'-di-(1-methylheptyl)-p-phenylenediamine |
| n,n'-di(octan-2-yl)benzene-1,4-diamine |
| p-Phenylenediamine,N,N'-bis(1-methylheptyl) |
| Antozite 1 |
| N,N'-Bis-(1-methyl-heptyl)-p-phenylendiamin |
| Santoflex 217 |
| 1,4-Benzenediamine,N,N'-bis(1-methylheptyl) |
| Elastozone 30 |
| Tenemene 30 |
| N,N'-bis(1-methylheptyl)-1,4-benzenediamine |
| N,N'-Bis(1-methylheptyl)-p-phenylenediamine |
| UOP 288 |