1,4-Benzenediamine,N1,N4-bis[(4-chlorophenyl)methylene]- structure
|
Common Name | 1,4-Benzenediamine,N1,N4-bis[(4-chlorophenyl)methylene]- | ||
|---|---|---|---|---|
| CAS Number | 17866-87-4 | Molecular Weight | 353.24500 | |
| Density | 1.18g/cm3 | Boiling Point | 513.4ºC at 760 mmHg | |
| Molecular Formula | C20H14Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.3ºC | |
| Name | 1-(4-chlorophenyl)-N-[4-[(4-chlorophenyl)methylideneamino]phenyl]methanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 513.4ºC at 760 mmHg |
| Molecular Formula | C20H14Cl2N2 |
| Molecular Weight | 353.24500 |
| Flash Point | 264.3ºC |
| Exact Mass | 352.05300 |
| PSA | 24.72000 |
| LogP | 6.49460 |
| Vapour Pressure | 3.83E-10mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | MSQKRZFWBVBWFU-UHFFFAOYSA-N |
| SMILES | Clc1ccc(C=Nc2ccc(N=Cc3ccc(Cl)cc3)cc2)cc1 |
|
~85%
1,4-Benzenediam... CAS#:17866-87-4 |
| Literature: Mohan, Jag; Kumar, Ashok Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2005 , vol. 44, # 3 p. 631 - 634 |
|
~94%
1,4-Benzenediam... CAS#:17866-87-4 |
| Literature: Parameswaran, Kandasamy; Sivaguru, Paramasivam; Lalitha, Appaswami Bioorganic and Medicinal Chemistry Letters, 2013 , vol. 23, # 13 p. 3873 - 3878 |
| N.N'-Bis-(4-chlor-benzal)-p-phenylendiamin |
| Bis-(4-chlor-benzyliden)-p-phenylendiamin |
| (1E)-1-{4-[(1E)-2-(4-chlorophenyl)-1-azavinyl]phenyl}-2-(4-chlorophenyl)-1-aza ethene |
| bis-(4-chloro-benzylidene)-p-phenylenediamine |
| p-bis(p-chlorobenzylidenamino)phenylene |