Tri(t-butoxycarbonylethoxymethyl) ethanol
Modify Date: 2025-08-25 12:22:41
Tri(t-butoxycarbonylethoxymethyl) ethanol structure
|
Common Name | Tri(t-butoxycarbonylethoxymethyl) ethanol | ||
|---|---|---|---|---|
| CAS Number | 1027581-61-8 | Molecular Weight | 520.65 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H48O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tri(t-butoxycarbonylethoxymethyl) ethanolTri(t-butoxycarbonylethoxymethyl) ethanol is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Tri(t-butoxycarbonylethoxymethyl) ethanol |
|---|
| Description | Tri(t-butoxycarbonylethoxymethyl) ethanol is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C26H48O10 |
|---|---|
| Molecular Weight | 520.65 |
| InChIKey | WVGDIZFVGPDHFP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCC(CO)(COCCC(=O)OC(C)(C)C)COCCC(=O)OC(C)(C)C |