N,N,N',N'-Tetramethyl-1,1-diphenylsilanediamine structure
|
Common Name | N,N,N',N'-Tetramethyl-1,1-diphenylsilanediamine | ||
|---|---|---|---|---|
| CAS Number | 1027-62-9 | Molecular Weight | 270.445 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 313.6±15.0 °C at 760 mmHg | |
| Molecular Formula | C16H22N2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.4±20.4 °C | |
| Name | N-[dimethylamino(diphenyl)silyl]-N-methylmethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 313.6±15.0 °C at 760 mmHg |
| Molecular Formula | C16H22N2Si |
| Molecular Weight | 270.445 |
| Flash Point | 143.4±20.4 °C |
| Exact Mass | 270.155212 |
| PSA | 6.48000 |
| LogP | 4.24 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | FTURFVPIEOKJBC-UHFFFAOYSA-N |
| SMILES | CN(C)[Si](c1ccccc1)(c1ccccc1)N(C)C |
| Risk Phrases | 34 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 3267 |
| HS Code | 2931900090 |
|
~%
N,N,N',N'-Tetra... CAS#:1027-62-9 |
| Literature: Journal of Organometallic Chemistry, , vol. 21, p. 59 - 64 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Bis-N.N'-tetramethyldiphenylsilylamin |
| Silanediamine, N,N,N',N'-tetramethyl-1,1-diphenyl- |
| Silanediamine,N,N,N',N'-tetramethyl-1,1-diphenyl |
| N,N,N',N'-Tetramethyl-1,1-diphenylsilanediamine |
| EINECS 213-838-9 |