2-Allyl-4,6-dibenzoylresorcinol structure
|
Common Name | 2-Allyl-4,6-dibenzoylresorcinol | ||
|---|---|---|---|---|
| CAS Number | 102593-74-8 | Molecular Weight | 358.387 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 579.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C23H18O4 | Melting Point | 158-163ºC | |
| MSDS | N/A | Flash Point | 318.4±25.2 °C | |
| Name | (5-benzoyl-2,4-dihydroxy-3-prop-2-enylphenyl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 579.7±45.0 °C at 760 mmHg |
| Melting Point | 158-163ºC |
| Molecular Formula | C23H18O4 |
| Molecular Weight | 358.387 |
| Flash Point | 318.4±25.2 °C |
| Exact Mass | 358.120514 |
| PSA | 74.60000 |
| LogP | 6.88 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | FSYGSBMXRNPJAD-UHFFFAOYSA-N |
| SMILES | C=CCc1c(O)c(C(=O)c2ccccc2)cc(C(=O)c2ccccc2)c1O |
|
~68%
2-Allyl-4,6-dib... CAS#:102593-74-8 |
| Literature: General Electric Company Patent: US5391795 A1, 1995 ; |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Methanone, 1,1'-[4,6-dihydroxy-5-(2-propen-1-yl)-1,3-phenylene]bis[1-phenyl- |
| 2-allyl-4,6-dibenzoylresorcinol |
| MFCD02094038 |
| (5-Allyl-4,6-dihydroxy-1,3-phenylene)bis(phenylmethanone) |