3-NITROFORMANILIDE structure
|
Common Name | 3-NITROFORMANILIDE | ||
|---|---|---|---|---|
| CAS Number | 102-38-5 | Molecular Weight | 166.13400 | |
| Density | 1.407 g/cm3 | Boiling Point | 368.5ºC at 760 mmHg | |
| Molecular Formula | C7H6N2O3 | Melting Point | 132-133ºC | |
| MSDS | N/A | Flash Point | 176.7ºC | |
| Name | N-(3-nitrophenyl)formamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.407 g/cm3 |
|---|---|
| Boiling Point | 368.5ºC at 760 mmHg |
| Melting Point | 132-133ºC |
| Molecular Formula | C7H6N2O3 |
| Molecular Weight | 166.13400 |
| Flash Point | 176.7ºC |
| Exact Mass | 166.03800 |
| PSA | 74.92000 |
| LogP | 2.39520 |
| Vapour Pressure | 1.27E-05mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | QCDUUALALDXTAD-UHFFFAOYSA-N |
| SMILES | O=CNc1cccc([N+](=O)[O-])c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R20/22 |
| Safety Phrases | S22-S36/37 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Nitro-formanilid |
| MFCD00017014 |
| m-Nitroformanilide |
| N-Formyl-m-nitroaniline |
| 3'-Nitroformanilide |
| N-formyl-3-nitroaniline |