4,6-Dichloroindole-2-carboxylic acid structure
|
Common Name | 4,6-Dichloroindole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 101861-63-6 | Molecular Weight | 230.048 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 476.9±40.0 °C at 760 mmHg | |
| Molecular Formula | C9H5Cl2NO2 | Melting Point | 47 °C | |
| MSDS | USA | Flash Point | 242.2±27.3 °C | |
| Name | 4,6-Dichloro-1H-indole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 476.9±40.0 °C at 760 mmHg |
| Melting Point | 47 °C |
| Molecular Formula | C9H5Cl2NO2 |
| Molecular Weight | 230.048 |
| Flash Point | 242.2±27.3 °C |
| Exact Mass | 228.969727 |
| PSA | 53.09000 |
| LogP | 3.51 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.731 |
| InChIKey | DHXISZKSSIWRLH-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc2c(Cl)cc(Cl)cc2[nH]1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2933990090 |
|
~85%
4,6-Dichloroind... CAS#:101861-63-6 |
| Literature: NOVARTIS AG; JIRICEK, Jan; KONDREDDI, Ravinder Reddy; SMITH, Paul William Patent: WO2014/37900 A1, 2014 ; Location in patent: Paragraph 27; 28 ; |
|
~%
4,6-Dichloroind... CAS#:101861-63-6 |
| Literature: WO2014/37900 A1, ; |
|
~%
4,6-Dichloroind... CAS#:101861-63-6 |
| Literature: WO2014/37900 A1, ; |
|
~%
4,6-Dichloroind... CAS#:101861-63-6 |
| Literature: WO2014/37900 A1, ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole-2-carboxylic acid, 4,6-dichloro- |
| MFCD00209870 |
| 4,6-Dichloro-1H-indole-2-carboxylic acid |
| 4,6-Dichlor-indol-2-carbonsaeure |
| 3-Dccip |
| 4,6-dichloro-indole-2-carboxylic acid |
| 4,6-Dichloro-1H-indole-2-carboxylicacid |
| 1H-Indole-2-carboxylicacid,4,6-dichloro |
| 4,6-Dichloroindole-2-carboxylic acid |