[dimethyl-[(2-methylpropan-2-yl)oxy]silyl]oxy-dimethyl-[(2-methylpropan-2-yl)oxy]silane structure
|
Common Name | [dimethyl-[(2-methylpropan-2-yl)oxy]silyl]oxy-dimethyl-[(2-methylpropan-2-yl)oxy]silane | ||
|---|---|---|---|---|
| CAS Number | 10175-46-9 | Molecular Weight | 278.53600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H30O3Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [dimethyl-[(2-methylpropan-2-yl)oxy]silyl]oxy-dimethyl-[(2-methylpropan-2-yl)oxy]silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H30O3Si2 |
|---|---|
| Molecular Weight | 278.53600 |
| Exact Mass | 278.17300 |
| PSA | 27.69000 |
| LogP | 4.03680 |
| InChIKey | RTYHBJMNRAJNSK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)O[Si](C)(C)O[Si](C)(C)OC(C)(C)C |
|
~%
[dimethyl-[(2-m... CAS#:10175-46-9 |
| Literature: Rajaraman, Suresh K.; Leatherman, Mark D.; Rojas-Wahl, Roy U.; Razzano, John S. Patent: US2005/265942 A1, 2005 ; Location in patent: Page/Page column 5-6 ; |
|
~%
[dimethyl-[(2-m... CAS#:10175-46-9 |
| Literature: Okawara; Imaeda Bulletin of the Chemical Society of Japan, 1958 , vol. 31, p. 194 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,3-Di-tert-butoxy-1,1,3,3-tetramethyl-disiloxan |
| 1,3-di-tert-butoxy-1,1,3,3-tetramethyl-disiloxane |
| 1,3-bis(tert-butoxy)tetramethyldisiloxane |
| di-t-butoxytetramethyldisiloxane |
| Disiloxane,1,3-bis(1,1-dimethylethoxy)-1,1,3,3-tetramethyl |