3-(3-Chlorophenyl)-3-Methylbutan-2-one
Modify Date: 2025-09-18 19:17:25
3-(3-Chlorophenyl)-3-Methylbutan-2-one structure
|
Common Name | 3-(3-Chlorophenyl)-3-Methylbutan-2-one | ||
|---|---|---|---|---|
| CAS Number | 1017478-92-0 | Molecular Weight | 196.67300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(3-chlorophenyl)-3-methylbutan-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13ClO |
|---|---|
| Molecular Weight | 196.67300 |
| Exact Mass | 196.06500 |
| PSA | 17.07000 |
| LogP | 3.20660 |
| InChIKey | HCRWDHCZGJQLJC-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C)(C)c1cccc(Cl)c1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-Butanone,3-(3-chlorophenyl)-3-methyl |