(5-Methyl-2-phenylthiazole-4-yl)acetic acid
Modify Date: 2025-09-11 18:47:03
(5-Methyl-2-phenylthiazole-4-yl)acetic acid structure
|
Common Name | (5-Methyl-2-phenylthiazole-4-yl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 101736-22-5 | Molecular Weight | 233.286 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 435.1±37.0 °C at 760 mmHg | |
| Molecular Formula | C12H11NO2S | Melting Point | 135-137ºC | |
| MSDS | N/A | Flash Point | 216.9±26.5 °C | |
| Name | 2-(5-methyl-2-phenyl-1,3-thiazol-4-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 435.1±37.0 °C at 760 mmHg |
| Melting Point | 135-137ºC |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.286 |
| Flash Point | 216.9±26.5 °C |
| Exact Mass | 233.051056 |
| PSA | 78.43000 |
| LogP | 2.99 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | SZYXURFSAUXFNT-UHFFFAOYSA-N |
| SMILES | Cc1sc(-c2ccccc2)nc1CC(=O)O |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2934100090 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| (5-Methyl-2-phenyl-1,3-thiazol-4-yl)acetic acid |
| (5-Methyl-2-phenylthiazole-4-yl)acetic acid |
| 2-(3,5-DIMETHYL-PYRAZOL-1-YL)-PHENYLAMINE |
| MFCD00277218 |
| (5-Methyl-2-phenyl-thiazol-4-yl)-essigsaeure |
| methylphenylthiazolylaceticacid |
| (5-methyl-2-phenyl-thiazol-4-yl)-acetic acid |
| 4-Thiazoleacetic acid, 5-methyl-2-phenyl- |
| 4-Thiazoleacetic acid,5-methyl-2-phenyl |