Phosphonium,dimethyldiphenyl-, iodide (1:1) structure
|
Common Name | Phosphonium,dimethyldiphenyl-, iodide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 1017-88-5 | Molecular Weight | 342.15500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16IP | Melting Point | 246-249ºC(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl(diphenyl)phosphanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 246-249ºC(lit.) |
|---|---|
| Molecular Formula | C14H16IP |
| Molecular Weight | 342.15500 |
| Exact Mass | 342.00300 |
| PSA | 13.59000 |
| InChIKey | MGLUUYLPGOWCNW-UHFFFAOYSA-M |
| SMILES | C[P+](C)(c1ccccc1)c1ccccc1.[I-] |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2931900090 |
| Precursor 8 | |
|---|---|
| DownStream 6 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| diphenyldimethylphosphonium iodide |
| Dimethyldiphenylphosphonium iodide |
| Dimethyl-diphenyl-phosphonium,Jodid |
| MFCD00031576 |