N-[6-(2,2-Dimethyl-propionylamino)-pyridin-2-yl]-2,2-dimethyl-propionamide structure
|
Common Name | N-[6-(2,2-Dimethyl-propionylamino)-pyridin-2-yl]-2,2-dimethyl-propionamide | ||
|---|---|---|---|---|
| CAS Number | 101630-94-8 | Molecular Weight | 277.36200 | |
| Density | 1.118g/cm3 | Boiling Point | 504.8ºC at 760 mmHg | |
| Molecular Formula | C15H23N3O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 259.1ºC | |
| Name | N-[6-(2,2-Dimethyl-propionylamino)-pyridin-2-yl]-2,2-dimethyl-propionamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.118g/cm3 |
|---|---|
| Boiling Point | 504.8ºC at 760 mmHg |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.36200 |
| Flash Point | 259.1ºC |
| Exact Mass | 277.17900 |
| PSA | 71.09000 |
| LogP | 3.19680 |
| Vapour Pressure | 2.58E-10mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | VPAGSMLGPQXYME-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)Nc1cccc(NC(=O)C(C)(C)C)n1 |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-[6-(2,2-dimethylpropanoylamino)pyridin-2-yl]-2,2-dimethylpropanamide |