poststerone structure
|
Common Name | poststerone | ||
|---|---|---|---|---|
| CAS Number | 10162-99-9 | Molecular Weight | 362.46 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H30O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of poststeronePoststerone is a nature product. Poststerone is a metabolite of insect metamorphosing substances from Cyathula capata[1]. |
| Name | poststerone |
|---|
| Description | Poststerone is a nature product. Poststerone is a metabolite of insect metamorphosing substances from Cyathula capata[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H30O5 |
|---|---|
| Molecular Weight | 362.46 |
| Exact Mass | 362.20900 |
| PSA | 94.83000 |
| LogP | 1.78000 |
| InChIKey | VNLQNGYIXVTQRR-NQPIQAHSSA-N |
| SMILES | CC(=O)C1CCC2(O)C3=CC(=O)C4CC(O)C(O)CC4(C)C3CCC12C |