2-Chloro-6-methoxyquinoline-3-carbonitrile
Modify Date: 2025-08-25 00:02:20
2-Chloro-6-methoxyquinoline-3-carbonitrile structure
|
Common Name | 2-Chloro-6-methoxyquinoline-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 101617-91-8 | Molecular Weight | 218.63900 | |
| Density | 1.36g/cm3 | Boiling Point | 396.5ºC at 760mmHg | |
| Molecular Formula | C11H7ClN2O | Melting Point | N/A | |
| MSDS | USA | Flash Point | 193.6ºC | |
| Name | 2-Chloro-6-methoxyquinoline-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 396.5ºC at 760mmHg |
| Molecular Formula | C11H7ClN2O |
| Molecular Weight | 218.63900 |
| Flash Point | 193.6ºC |
| Exact Mass | 218.02500 |
| PSA | 45.91000 |
| LogP | 2.76848 |
| Vapour Pressure | 1.71E-06mmHg at 25°C |
| Index of Refraction | 1.64 |
| InChIKey | AMFXVCDHDIEGIM-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc(Cl)c(C#N)cc2c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933499090 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-methoxy-2-chloro-3-cyanoquinoline |
| 3-Quinolinecarbonitrile,2-chloro-6-methoxy |
| 2-chloro-6-methoxy-3-quinolinecarbonitrile |
| 2-chloro-3-cyano-6-methoxyquinoline |